C24H32ClN5O3 — CID 70823397
2-[5-chloro-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-(3-hydroxy-1-pyridin-4-ylpropyl)acetamide (PubChem CID 70823397) has the molecular formula C24H32ClN5O3 and a molecular weight of 474.01 g/mol. Its IUPAC name is 2-[5-chloro-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-(3-hydroxy-1-pyridin-4-ylpropyl)acetamide.
| Compound Name | 2-[5-chloro-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-(3-hydroxy-1-pyridin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 70823397 |
| Molecular Formula | C24H32ClN5O3 |
| Molecular Weight | 474.01 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 2-[5-chloro-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-(3-hydroxy-1-pyridin-4-ylpropyl)acetamide |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1Nc1cnn(CC(=O)NC(CCO)c3ccncc3)c(=O)c1Cl)C2(C)C |
| InChI | InChI=1S/C24H32ClN5O3/c1-14-17-10-16(24(17,2)3)11-19(14)28-20-12-27-30(23(33)22(20)25)13-21(32)29-18(6-9-31)15-4-7-26-8-5-15/h4-5,7-8,12,14,16-19,28,31H,6,9-11,13H2,1-3H3,(H,29,32)/t14-,16+,17-,18?,19-/m1/s1 |
| InChIKey | YHGRWLABDZJXSQ-OPPBIHTLSA-N |
| XLogP | 3.01 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.01 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |