C25H34N6O4 — CID 150675809
3-[3-oxo-2-[2-oxo-2-(1-pyridazin-4-ylethylamino)ethyl]-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-4-yl]propanoic acid (PubChem CID 150675809) has the molecular formula C25H34N6O4 and a molecular weight of 482.59 g/mol. Its IUPAC name is 3-[3-oxo-2-[2-oxo-2-(1-pyridazin-4-ylethylamino)ethyl]-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-4-yl]propanoic acid.
| Compound Name | 3-[3-oxo-2-[2-oxo-2-(1-pyridazin-4-ylethylamino)ethyl]-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 150675809 |
| Molecular Formula | C25H34N6O4 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | 3-[3-oxo-2-[2-oxo-2-(1-pyridazin-4-ylethylamino)ethyl]-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-4-yl]propanoic acid |
| SMILES | CC(NC(=O)Cn1ncc(N[C@@H]2C[C@@H]3C[C@H]([C@H]2C)C3(C)C)c(CCC(=O)O)c1=O)c1ccnnc1 |
| InChI | InChI=1S/C25H34N6O4/c1-14-19-9-17(25(19,3)4)10-20(14)30-21-12-28-31(24(35)18(21)5-6-23(33)34)13-22(32)29-15(2)16-7-8-26-27-11-16/h7-8,11-12,14-15,17,19-20,30H,5-6,9-10,13H2,1-4H3,(H,29,32)(H,33,34)/t14-,15?,17+,19-,20-/m1/s1 |
| InChIKey | JGWFTTFDLIVIMN-RNPPNRBOSA-N |
| XLogP | 2.41 |
| TPSA | 139.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |