C29H41BrN4O2 — CID 90989326
4-bromo-2-[4-[2,6-di(propan-2-yl)-4-pyridinyl]-2-oxobutyl]-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one (PubChem CID 90989326) has the molecular formula C29H41BrN4O2 and a molecular weight of 557.58 g/mol. Its IUPAC name is 4-bromo-2-[4-[2,6-di(propan-2-yl)-4-pyridinyl]-2-oxobutyl]-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one.
| Compound Name | 4-bromo-2-[4-[2,6-di(propan-2-yl)-4-pyridinyl]-2-oxobutyl]-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 90989326 |
| Molecular Formula | C29H41BrN4O2 |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | 4-bromo-2-[4-[2,6-di(propan-2-yl)-4-pyridinyl]-2-oxobutyl]-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
| SMILES | CC(C)c1cc(CCC(=O)Cn2ncc(N[C@@H]3C[C@@H]4C[C@H]([C@H]3C)C4(C)C)c(Br)c2=O)cc(C(C)C)n1 |
| InChI | InChI=1S/C29H41BrN4O2/c1-16(2)23-10-19(11-24(32-23)17(3)4)8-9-21(35)15-34-28(36)27(30)26(14-31-34)33-25-13-20-12-22(18(25)5)29(20,6)7/h10-11,14,16-18,20,22,25,33H,8-9,12-13,15H2,1-7H3/t18-,20+,22-,25-/m1/s1 |
| InChIKey | MVXPMNFVKDNTOZ-DPQLKAKJSA-N |
| XLogP | 6.33 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |