C22H28BrN3O2S — CID 90943587
4-bromo-2-(2-oxo-4-thiophen-2-ylbutyl)-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one (PubChem CID 90943587) has the molecular formula C22H28BrN3O2S and a molecular weight of 478.46 g/mol. Its IUPAC name is 4-bromo-2-(2-oxo-4-thiophen-2-ylbutyl)-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one.
| Compound Name | 4-bromo-2-(2-oxo-4-thiophen-2-ylbutyl)-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 90943587 |
| Molecular Formula | C22H28BrN3O2S |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 4-bromo-2-(2-oxo-4-thiophen-2-ylbutyl)-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1Nc1cnn(CC(=O)CCc3cccs3)c(=O)c1Br)C2(C)C |
| InChI | InChI=1S/C22H28BrN3O2S/c1-13-17-9-14(22(17,2)3)10-18(13)25-19-11-24-26(21(28)20(19)23)12-15(27)6-7-16-5-4-8-29-16/h4-5,8,11,13-14,17-18,25H,6-7,9-10,12H2,1-3H3/t13-,14+,17-,18-/m1/s1 |
| InChIKey | NKTDSUOFRKAMES-LTCOOKNTSA-N |
| XLogP | 4.75 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |