C25H32BrN3O3 — CID 91299471
4-bromo-2-[4-(2-methoxyphenyl)-2-oxobutyl]-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one (PubChem CID 91299471) has the molecular formula C25H32BrN3O3 and a molecular weight of 502.45 g/mol. Its IUPAC name is 4-bromo-2-[4-(2-methoxyphenyl)-2-oxobutyl]-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one.
| Compound Name | 4-bromo-2-[4-(2-methoxyphenyl)-2-oxobutyl]-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 91299471 |
| Molecular Formula | C25H32BrN3O3 |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | 4-bromo-2-[4-(2-methoxyphenyl)-2-oxobutyl]-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
| SMILES | COc1ccccc1CCC(=O)Cn1ncc(N[C@@H]2C[C@@H]3C[C@H]([C@H]2C)C3(C)C)c(Br)c1=O |
| InChI | InChI=1S/C25H32BrN3O3/c1-15-19-11-17(25(19,2)3)12-20(15)28-21-13-27-29(24(31)23(21)26)14-18(30)10-9-16-7-5-6-8-22(16)32-4/h5-8,13,15,17,19-20,28H,9-12,14H2,1-4H3/t15-,17+,19-,20-/m1/s1 |
| InChIKey | RDMVKYLNJXSQJU-MCYKXBRJSA-N |
| XLogP | 4.70 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |