C26H32BrN3O2 — CID 91445579
4-bromo-2-[3-(2,3-dihydro-1H-inden-1-yl)-2-oxopropyl]-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one (PubChem CID 91445579) has the molecular formula C26H32BrN3O2 and a molecular weight of 498.47 g/mol. Its IUPAC name is 4-bromo-2-[3-(2,3-dihydro-1H-inden-1-yl)-2-oxopropyl]-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one.
| Compound Name | 4-bromo-2-[3-(2,3-dihydro-1H-inden-1-yl)-2-oxopropyl]-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 91445579 |
| Molecular Formula | C26H32BrN3O2 |
| Molecular Weight | 498.47 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 4-bromo-2-[3-(2,3-dihydro-1H-inden-1-yl)-2-oxopropyl]-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1Nc1cnn(CC(=O)CC3CCc4ccccc43)c(=O)c1Br)C2(C)C |
| InChI | InChI=1S/C26H32BrN3O2/c1-15-21-11-18(26(21,2)3)12-22(15)29-23-13-28-30(25(32)24(23)27)14-19(31)10-17-9-8-16-6-4-5-7-20(16)17/h4-7,13,15,17-18,21-22,29H,8-12,14H2,1-3H3/t15-,17?,18+,21-,22-/m1/s1 |
| InChIKey | NGURNJYTDTVAOJ-PEMQPZBYSA-N |
| XLogP | 5.18 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |