C24H36BrN3O2 — CID 91411266
4-bromo-2-(4-cyclohexyl-2-oxobutyl)-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one (PubChem CID 91411266) has the molecular formula C24H36BrN3O2 and a molecular weight of 478.48 g/mol. Its IUPAC name is 4-bromo-2-(4-cyclohexyl-2-oxobutyl)-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one.
| Compound Name | 4-bromo-2-(4-cyclohexyl-2-oxobutyl)-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 91411266 |
| Molecular Formula | C24H36BrN3O2 |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 4-bromo-2-(4-cyclohexyl-2-oxobutyl)-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1Nc1cnn(CC(=O)CCC3CCCCC3)c(=O)c1Br)C2(C)C |
| InChI | InChI=1S/C24H36BrN3O2/c1-15-19-11-17(24(19,2)3)12-20(15)27-21-13-26-28(23(30)22(21)25)14-18(29)10-9-16-7-5-4-6-8-16/h13,15-17,19-20,27H,4-12,14H2,1-3H3/t15-,17+,19-,20-/m1/s1 |
| InChIKey | RWCPWAGDMARQSO-MCYKXBRJSA-N |
| XLogP | 5.42 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |