C25H29BrN4O2S — CID 91057072
2-[4-(1,3-benzothiazol-2-yl)-2-oxobutyl]-4-bromo-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one (PubChem CID 91057072) has the molecular formula C25H29BrN4O2S and a molecular weight of 529.50 g/mol. Its IUPAC name is 2-[4-(1,3-benzothiazol-2-yl)-2-oxobutyl]-4-bromo-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one.
| Compound Name | 2-[4-(1,3-benzothiazol-2-yl)-2-oxobutyl]-4-bromo-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 91057072 |
| Molecular Formula | C25H29BrN4O2S |
| Molecular Weight | 529.50 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 2-[4-(1,3-benzothiazol-2-yl)-2-oxobutyl]-4-bromo-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1Nc1cnn(CC(=O)CCc3nc4ccccc4s3)c(=O)c1Br)C2(C)C |
| InChI | InChI=1S/C25H29BrN4O2S/c1-14-17-10-15(25(17,2)3)11-19(14)28-20-12-27-30(24(32)23(20)26)13-16(31)8-9-22-29-18-6-4-5-7-21(18)33-22/h4-7,12,14-15,17,19,28H,8-11,13H2,1-3H3/t14-,15+,17-,19-/m1/s1 |
| InChIKey | NWPFZUAFYQAMJC-LORHWOILSA-N |
| XLogP | 5.30 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |