C24H31ClN4O3 — CID 59574613
2-[5-chloro-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[(3-methoxyphenyl)methyl]acetamide (PubChem CID 59574613) has the molecular formula C24H31ClN4O3 and a molecular weight of 458.99 g/mol. Its IUPAC name is 2-[5-chloro-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[(3-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[5-chloro-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[(3-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 59574613 |
| Molecular Formula | C24H31ClN4O3 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 2-[5-chloro-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[(3-methoxyphenyl)methyl]acetamide |
| SMILES | COc1cccc(CNC(=O)Cn2ncc(N[C@@H]3C[C@H]4C[C@@H]([C@H]3C)C4(C)C)c(Cl)c2=O)c1 |
| InChI | InChI=1S/C24H31ClN4O3/c1-14-18-9-16(24(18,2)3)10-19(14)28-20-12-27-29(23(31)22(20)25)13-21(30)26-11-15-6-5-7-17(8-15)32-4/h5-8,12,14,16,18-19,28H,9-11,13H2,1-4H3,(H,26,30)/t14-,16-,18+,19-/m1/s1 |
| InChIKey | IFBBFCXYDZQEIL-SKWUIDRYSA-N |
| XLogP | 3.70 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |