C19H28ClN3O3 — CID 143799796
ethyl 2-[5-chloro-6-oxo-4-[[(1R,2R,3R,5S)-2,8,8-trimethyl-3-bicyclo[3.2.1]octanyl]amino]pyridazin-1-yl]acetate (PubChem CID 143799796) has the molecular formula C19H28ClN3O3 and a molecular weight of 381.90 g/mol. Its IUPAC name is ethyl 2-[5-chloro-6-oxo-4-[[(1R,2R,3R,5S)-2,8,8-trimethyl-3-bicyclo[3.2.1]octanyl]amino]pyridazin-1-yl]acetate.
| Compound Name | ethyl 2-[5-chloro-6-oxo-4-[[(1R,2R,3R,5S)-2,8,8-trimethyl-3-bicyclo[3.2.1]octanyl]amino]pyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 143799796 |
| Molecular Formula | C19H28ClN3O3 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | ethyl 2-[5-chloro-6-oxo-4-[[(1R,2R,3R,5S)-2,8,8-trimethyl-3-bicyclo[3.2.1]octanyl]amino]pyridazin-1-yl]acetate |
| SMILES | CCOC(=O)Cn1ncc(N[C@@H]2C[C@@H]3CC[C@H]([C@H]2C)C3(C)C)c(Cl)c1=O |
| InChI | InChI=1S/C19H28ClN3O3/c1-5-26-16(24)10-23-18(25)17(20)15(9-21-23)22-14-8-12-6-7-13(11(14)2)19(12,3)4/h9,11-14,22H,5-8,10H2,1-4H3/t11-,12+,13-,14-/m1/s1 |
| InChIKey | LCXSLRROJXCTQH-XJFOESAGSA-N |
| XLogP | 3.33 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |