C13H18ClN3O3 — CID 114437732
methyl 2-[5-chloro-4-[(2-methylcyclopentyl)amino]-6-oxopyridazin-1-yl]acetate (PubChem CID 114437732) has the molecular formula C13H18ClN3O3 and a molecular weight of 299.76 g/mol. Its IUPAC name is methyl 2-[5-chloro-4-[(2-methylcyclopentyl)amino]-6-oxopyridazin-1-yl]acetate.
| Compound Name | methyl 2-[5-chloro-4-[(2-methylcyclopentyl)amino]-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 114437732 |
| Molecular Formula | C13H18ClN3O3 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | methyl 2-[5-chloro-4-[(2-methylcyclopentyl)amino]-6-oxopyridazin-1-yl]acetate |
| SMILES | COC(=O)Cn1ncc(NC2CCCC2C)c(Cl)c1=O |
| InChI | InChI=1S/C13H18ClN3O3/c1-8-4-3-5-9(8)16-10-6-15-17(7-11(18)20-2)13(19)12(10)14/h6,8-9,16H,3-5,7H2,1-2H3 |
| InChIKey | LBOUKKRJIUIGCK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |