C13H19ClN4O3 — CID 106995982
methyl 2-[5-chloro-4-[(2-methylpiperidin-4-yl)amino]-6-oxopyridazin-1-yl]acetate (PubChem CID 106995982) has the molecular formula C13H19ClN4O3 and a molecular weight of 314.77 g/mol. Its IUPAC name is methyl 2-[5-chloro-4-[(2-methylpiperidin-4-yl)amino]-6-oxopyridazin-1-yl]acetate.
| Compound Name | methyl 2-[5-chloro-4-[(2-methylpiperidin-4-yl)amino]-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 106995982 |
| Molecular Formula | C13H19ClN4O3 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | methyl 2-[5-chloro-4-[(2-methylpiperidin-4-yl)amino]-6-oxopyridazin-1-yl]acetate |
| SMILES | COC(=O)Cn1ncc(NC2CCNC(C)C2)c(Cl)c1=O |
| InChI | InChI=1S/C13H19ClN4O3/c1-8-5-9(3-4-15-8)17-10-6-16-18(7-11(19)21-2)13(20)12(10)14/h6,8-9,15,17H,3-5,7H2,1-2H3 |
| InChIKey | SZYVVLGGUZDKSF-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |