C13H21ClN4O2 — CID 106995934
4-chloro-2-(2-methoxyethyl)-5-[(2-methylpiperidin-4-yl)amino]pyridazin-3-one (PubChem CID 106995934) has the molecular formula C13H21ClN4O2 and a molecular weight of 300.79 g/mol. Its IUPAC name is 4-chloro-2-(2-methoxyethyl)-5-[(2-methylpiperidin-4-yl)amino]pyridazin-3-one.
| Compound Name | 4-chloro-2-(2-methoxyethyl)-5-[(2-methylpiperidin-4-yl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 106995934 |
| Molecular Formula | C13H21ClN4O2 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 4-chloro-2-(2-methoxyethyl)-5-[(2-methylpiperidin-4-yl)amino]pyridazin-3-one |
| SMILES | COCCn1ncc(NC2CCNC(C)C2)c(Cl)c1=O |
| InChI | InChI=1S/C13H21ClN4O2/c1-9-7-10(3-4-15-9)17-11-8-16-18(5-6-20-2)13(19)12(11)14/h8-10,15,17H,3-7H2,1-2H3 |
| InChIKey | KPSJBJTUUJKGSI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |