C12H19ClN4O3 — CID 104922040
4-chloro-2-(2-methoxyethyl)-5-[[(4S)-4-methoxypyrrolidin-3-yl]amino]pyridazin-3-one (PubChem CID 104922040) has the molecular formula C12H19ClN4O3 and a molecular weight of 302.76 g/mol. Its IUPAC name is 4-chloro-2-(2-methoxyethyl)-5-[[(4S)-4-methoxypyrrolidin-3-yl]amino]pyridazin-3-one.
| Compound Name | 4-chloro-2-(2-methoxyethyl)-5-[[(4S)-4-methoxypyrrolidin-3-yl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 104922040 |
| Molecular Formula | C12H19ClN4O3 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 4-chloro-2-(2-methoxyethyl)-5-[[(4S)-4-methoxypyrrolidin-3-yl]amino]pyridazin-3-one |
| SMILES | COCCn1ncc(NC2CNC[C@@H]2OC)c(Cl)c1=O |
| InChI | InChI=1S/C12H19ClN4O3/c1-19-4-3-17-12(18)11(13)9(6-15-17)16-8-5-14-7-10(8)20-2/h6,8,10,14,16H,3-5,7H2,1-2H3/t8?,10-/m0/s1 |
| InChIKey | JDPJNRGGEBLSJP-HTLJXXAVSA-N |
| XLogP | -0.06 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |