C12H16ClN3O4 — CID 114440922
methyl 2-[5-chloro-4-[(2-methyloxolan-3-yl)amino]-6-oxopyridazin-1-yl]acetate (PubChem CID 114440922) has the molecular formula C12H16ClN3O4 and a molecular weight of 301.73 g/mol. Its IUPAC name is methyl 2-[5-chloro-4-[(2-methyloxolan-3-yl)amino]-6-oxopyridazin-1-yl]acetate.
| Compound Name | methyl 2-[5-chloro-4-[(2-methyloxolan-3-yl)amino]-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 114440922 |
| Molecular Formula | C12H16ClN3O4 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | methyl 2-[5-chloro-4-[(2-methyloxolan-3-yl)amino]-6-oxopyridazin-1-yl]acetate |
| SMILES | COC(=O)Cn1ncc(NC2CCOC2C)c(Cl)c1=O |
| InChI | InChI=1S/C12H16ClN3O4/c1-7-8(3-4-20-7)15-9-5-14-16(6-10(17)19-2)12(18)11(9)13/h5,7-8,15H,3-4,6H2,1-2H3 |
| InChIKey | KCBMIEXPKODRKE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |