C11H13ClN4O4 — CID 106191964
methyl 2-[5-chloro-6-oxo-4-[(5-oxopyrrolidin-3-yl)amino]pyridazin-1-yl]acetate (PubChem CID 106191964) has the molecular formula C11H13ClN4O4 and a molecular weight of 300.70 g/mol. Its IUPAC name is methyl 2-[5-chloro-6-oxo-4-[(5-oxopyrrolidin-3-yl)amino]pyridazin-1-yl]acetate.
| Compound Name | methyl 2-[5-chloro-6-oxo-4-[(5-oxopyrrolidin-3-yl)amino]pyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 106191964 |
| Molecular Formula | C11H13ClN4O4 |
| Molecular Weight | 300.70 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | methyl 2-[5-chloro-6-oxo-4-[(5-oxopyrrolidin-3-yl)amino]pyridazin-1-yl]acetate |
| SMILES | COC(=O)Cn1ncc(NC2CNC(=O)C2)c(Cl)c1=O |
| InChI | InChI=1S/C11H13ClN4O4/c1-20-9(18)5-16-11(19)10(12)7(4-14-16)15-6-2-8(17)13-3-6/h4,6,15H,2-3,5H2,1H3,(H,13,17) |
| InChIKey | KWZRLDQGCZVYSD-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.70 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |