C14H20ClN3O3 — CID 107413789
methyl 2-[5-chloro-4-[(3-methylcyclopentyl)methylamino]-6-oxopyridazin-1-yl]acetate (PubChem CID 107413789) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.79 g/mol. Its IUPAC name is methyl 2-[5-chloro-4-[(3-methylcyclopentyl)methylamino]-6-oxopyridazin-1-yl]acetate.
| Compound Name | methyl 2-[5-chloro-4-[(3-methylcyclopentyl)methylamino]-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 107413789 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | methyl 2-[5-chloro-4-[(3-methylcyclopentyl)methylamino]-6-oxopyridazin-1-yl]acetate |
| SMILES | COC(=O)Cn1ncc(NCC2CCC(C)C2)c(Cl)c1=O |
| InChI | InChI=1S/C14H20ClN3O3/c1-9-3-4-10(5-9)6-16-11-7-17-18(8-12(19)21-2)14(20)13(11)15/h7,9-10,16H,3-6,8H2,1-2H3 |
| InChIKey | AHRSGWGWEIUAKQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |