C21H28ClN6O3+ — CID 123298576
2-[5-chloro-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[(3-oxo-4H-pyridazin-1-ium-4-yl)methyl]acetamide (PubChem CID 123298576) has the molecular formula C21H28ClN6O3+ and a molecular weight of 447.95 g/mol. Its IUPAC name is 2-[5-chloro-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[(3-oxo-4H-pyridazin-1-ium-4-yl)methyl]acetamide.
| Compound Name | 2-[5-chloro-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[(3-oxo-4H-pyridazin-1-ium-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 123298576 |
| Molecular Formula | C21H28ClN6O3+ |
| Molecular Weight | 447.95 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 2-[5-chloro-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[(3-oxo-4H-pyridazin-1-ium-4-yl)methyl]acetamide |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1Nc1cnn(CC(=O)NCC3C=C[NH+]=NC3=O)c(=O)c1Cl)C2(C)C |
| InChI | InChI=1S/C21H27ClN6O3/c1-11-14-6-13(21(14,2)3)7-15(11)26-16-9-25-28(20(31)18(16)22)10-17(29)23-8-12-4-5-24-27-19(12)30/h4-5,9,11-15,26H,6-8,10H2,1-3H3,(H,23,29)/p+1/t11-,12?,13+,14-,15-/m1/s1 |
| InChIKey | NOGGUCJASODXST-ZQQMXMEDSA-O |
| XLogP | 0.70 |
| TPSA | 119.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.95 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |