C23H31ClN6O3 — CID 59574799
2-[5-chloro-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[1-(3-methoxypyridazin-4-yl)ethyl]acetamide (PubChem CID 59574799) has the molecular formula C23H31ClN6O3 and a molecular weight of 474.99 g/mol. Its IUPAC name is 2-[5-chloro-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[1-(3-methoxypyridazin-4-yl)ethyl]acetamide.
| Compound Name | 2-[5-chloro-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[1-(3-methoxypyridazin-4-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 59574799 |
| Molecular Formula | C23H31ClN6O3 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 2-[5-chloro-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[1-(3-methoxypyridazin-4-yl)ethyl]acetamide |
| SMILES | COc1nnccc1C(C)NC(=O)Cn1ncc(N[C@@H]2C[C@H]3C[C@@H]([C@H]2C)C3(C)C)c(Cl)c1=O |
| InChI | InChI=1S/C23H31ClN6O3/c1-12-16-8-14(23(16,3)4)9-17(12)28-18-10-26-30(22(32)20(18)24)11-19(31)27-13(2)15-6-7-25-29-21(15)33-5/h6-7,10,12-14,16-17,28H,8-9,11H2,1-5H3,(H,27,31)/t12-,13?,14-,16+,17-/m1/s1 |
| InChIKey | BMDUNZCXILDGOJ-XSKKGZJDSA-N |
| XLogP | 3.06 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |