C24H32ClN5O2 — CID 59574524
2-[5-chloro-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[3-(dimethylamino)phenyl]acetamide (PubChem CID 59574524) has the molecular formula C24H32ClN5O2 and a molecular weight of 458.01 g/mol. Its IUPAC name is 2-[5-chloro-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[3-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-[5-chloro-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[3-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 59574524 |
| Molecular Formula | C24H32ClN5O2 |
| Molecular Weight | 458.01 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 2-[5-chloro-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[3-(dimethylamino)phenyl]acetamide |
| SMILES | C[C@H]1[C@H](Nc2cnn(CC(=O)Nc3cccc(N(C)C)c3)c(=O)c2Cl)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C24H32ClN5O2/c1-14-18-9-15(24(18,2)3)10-19(14)28-20-12-26-30(23(32)22(20)25)13-21(31)27-16-7-6-8-17(11-16)29(4)5/h6-8,11-12,14-15,18-19,28H,9-10,13H2,1-5H3,(H,27,31)/t14-,15-,18+,19-/m1/s1 |
| InChIKey | BGXNGENDBGPJOU-VVWQDTPRSA-N |
| XLogP | 4.08 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.01 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |