C22H28BrN5O2 — CID 59574443
N-[2-[5-bromo-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]ethyl]pyridine-4-carboxamide (PubChem CID 59574443) has the molecular formula C22H28BrN5O2 and a molecular weight of 474.40 g/mol. Its IUPAC name is N-[2-[5-bromo-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]ethyl]pyridine-4-carboxamide.
| Compound Name | N-[2-[5-bromo-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 59574443 |
| Molecular Formula | C22H28BrN5O2 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | N-[2-[5-bromo-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]ethyl]pyridine-4-carboxamide |
| SMILES | C[C@H]1[C@H](Nc2cnn(CCNC(=O)c3ccncc3)c(=O)c2Br)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C22H28BrN5O2/c1-13-16-10-15(22(16,2)3)11-17(13)27-18-12-26-28(21(30)19(18)23)9-8-25-20(29)14-4-6-24-7-5-14/h4-7,12-13,15-17,27H,8-11H2,1-3H3,(H,25,29)/t13-,15-,16+,17-/m1/s1 |
| InChIKey | FDMFQXCSBUGJGW-MXASKKJJSA-N |
| XLogP | 3.31 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |