C19H28BrN3O3 — CID 59574464
ethyl 2-[5-bromo-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]propanoate (PubChem CID 59574464) has the molecular formula C19H28BrN3O3 and a molecular weight of 426.36 g/mol. Its IUPAC name is ethyl 2-[5-bromo-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]propanoate.
| Compound Name | ethyl 2-[5-bromo-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]propanoate |
|---|---|
| PubChem CID | 59574464 |
| Molecular Formula | C19H28BrN3O3 |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | ethyl 2-[5-bromo-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]propanoate |
| SMILES | CCOC(=O)C(C)n1ncc(N[C@@H]2C[C@H]3C[C@@H]([C@H]2C)C3(C)C)c(Br)c1=O |
| InChI | InChI=1S/C19H28BrN3O3/c1-6-26-18(25)11(3)23-17(24)16(20)15(9-21-23)22-14-8-12-7-13(10(14)2)19(12,4)5/h9-14,22H,6-8H2,1-5H3/t10-,11?,12-,13+,14-/m1/s1 |
| InChIKey | VQZOUMOTIZMZDQ-RKFYDKJMSA-N |
| XLogP | 3.61 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |