C31H33NO2 — CID 20685417
2-[4-[[3-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]phenyl]methoxy]phenyl]ethanamine (PubChem CID 20685417) has the molecular formula C31H33NO2 and a molecular weight of 451.61 g/mol. Its IUPAC name is 2-[4-[[3-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]phenyl]methoxy]phenyl]ethanamine.
| Compound Name | 2-[4-[[3-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]phenyl]methoxy]phenyl]ethanamine |
|---|---|
| PubChem CID | 20685417 |
| Molecular Formula | C31H33NO2 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 2-[4-[[3-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]phenyl]methoxy]phenyl]ethanamine |
| SMILES | CC(C)(c1ccccc1)c1ccc(OCc2cccc(COc3ccc(CCN)cc3)c2)cc1 |
| InChI | InChI=1S/C31H33NO2/c1-31(2,27-9-4-3-5-10-27)28-13-17-30(18-14-28)34-23-26-8-6-7-25(21-26)22-33-29-15-11-24(12-16-29)19-20-32/h3-18,21H,19-20,22-23,32H2,1-2H3 |
| InChIKey | QLWJVTMMPZXZLF-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |