C17H22ClNO3 — CID 11666965
2-[4-[(3,5-dimethoxyphenyl)methoxy]phenyl]ethanamine;hydrochloride (PubChem CID 11666965) has the molecular formula C17H22ClNO3 and a molecular weight of 323.82 g/mol. Its IUPAC name is 2-[4-[(3,5-dimethoxyphenyl)methoxy]phenyl]ethanamine;hydrochloride.
| Compound Name | 2-[4-[(3,5-dimethoxyphenyl)methoxy]phenyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 11666965 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-[4-[(3,5-dimethoxyphenyl)methoxy]phenyl]ethanamine;hydrochloride |
| SMILES | COc1cc(COc2ccc(CCN)cc2)cc(OC)c1.Cl |
| InChI | InChI=1S/C17H21NO3.ClH/c1-19-16-9-14(10-17(11-16)20-2)12-21-15-5-3-13(4-6-15)7-8-18;/h3-6,9-11H,7-8,12,18H2,1-2H3;1H |
| InChIKey | VYYCZTOXMFANJY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |