C27H29ClN3O6P — CID 16724579
ethyl 2-[[(4-chlorophenyl)-[phenyl-[[2-(phenylmethoxycarbonylamino)acetyl]amino]methyl]phosphoryl]amino]acetate (PubChem CID 16724579) has the molecular formula C27H29ClN3O6P and a molecular weight of 557.97 g/mol. Its IUPAC name is ethyl 2-[[(4-chlorophenyl)-[phenyl-[[2-(phenylmethoxycarbonylamino)acetyl]amino]methyl]phosphoryl]amino]acetate.
| Compound Name | ethyl 2-[[(4-chlorophenyl)-[phenyl-[[2-(phenylmethoxycarbonylamino)acetyl]amino]methyl]phosphoryl]amino]acetate |
|---|---|
| PubChem CID | 16724579 |
| Molecular Formula | C27H29ClN3O6P |
| Molecular Weight | 557.97 g/mol |
| Exact Mass | 557.15 |
| IUPAC Name | ethyl 2-[[(4-chlorophenyl)-[phenyl-[[2-(phenylmethoxycarbonylamino)acetyl]amino]methyl]phosphoryl]amino]acetate |
| SMILES | CCOC(=O)CNP(=O)(c1ccc(Cl)cc1)C(NC(=O)CNC(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29ClN3O6P/c1-2-36-25(33)18-30-38(35,23-15-13-22(28)14-16-23)26(21-11-7-4-8-12-21)31-24(32)17-29-27(34)37-19-20-9-5-3-6-10-20/h3-16,26H,2,17-19H2,1H3,(H,29,34)(H,30,35)(H,31,32) |
| InChIKey | RDGDKHNDQJSGJM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.97 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|