C25H29F3NO10P — CID 71014435
[[4-(2-ethoxy-2-oxoethoxy)-3-(trifluoromethyl)phenyl]-hydroxymethyl]-[4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid (PubChem CID 71014435) has the molecular formula C25H29F3NO10P and a molecular weight of 591.47 g/mol. Its IUPAC name is [[4-(2-ethoxy-2-oxoethoxy)-3-(trifluoromethyl)phenyl]-hydroxymethyl]-[4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid.
| Compound Name | [[4-(2-ethoxy-2-oxoethoxy)-3-(trifluoromethyl)phenyl]-hydroxymethyl]-[4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid |
|---|---|
| PubChem CID | 71014435 |
| Molecular Formula | C25H29F3NO10P |
| Molecular Weight | 591.47 g/mol |
| Exact Mass | 591.15 |
| IUPAC Name | [[4-(2-ethoxy-2-oxoethoxy)-3-(trifluoromethyl)phenyl]-hydroxymethyl]-[4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid |
| SMILES | CCOC(=O)COc1ccc(C(O)P(=O)(O)CCC(NC(=O)OCc2ccccc2)C(=O)OC)cc1C(F)(F)F |
| InChI | InChI=1S/C25H29F3NO10P/c1-3-37-21(30)15-38-20-10-9-17(13-18(20)25(26,27)28)23(32)40(34,35)12-11-19(22(31)36-2)29-24(33)39-14-16-7-5-4-6-8-16/h4-10,13,19,23,32H,3,11-12,14-15H2,1-2H3,(H,29,33)(H,34,35) |
| InChIKey | OADYJYPBCYIUSD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 157.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|