C21H22F3N2O9P — CID 91295527
[hydroxy-[3-nitro-4-(trifluoromethyl)phenyl]methyl]-[(3R)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid (PubChem CID 91295527) has the molecular formula C21H22F3N2O9P and a molecular weight of 534.38 g/mol. Its IUPAC name is [hydroxy-[3-nitro-4-(trifluoromethyl)phenyl]methyl]-[(3R)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid.
| Compound Name | [hydroxy-[3-nitro-4-(trifluoromethyl)phenyl]methyl]-[(3R)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid |
|---|---|
| PubChem CID | 91295527 |
| Molecular Formula | C21H22F3N2O9P |
| Molecular Weight | 534.38 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | [hydroxy-[3-nitro-4-(trifluoromethyl)phenyl]methyl]-[(3R)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid |
| SMILES | COC(=O)[C@@H](CCP(=O)(O)C(O)c1ccc(C(F)(F)F)c([N+](=O)[O-])c1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H22F3N2O9P/c1-34-18(27)16(25-20(29)35-12-13-5-3-2-4-6-13)9-10-36(32,33)19(28)14-7-8-15(21(22,23)24)17(11-14)26(30)31/h2-8,11,16,19,28H,9-10,12H2,1H3,(H,25,29)(H,32,33)/t16-,19?/m1/s1 |
| InChIKey | WEYFQXAMCBMHBM-VTBWFHPJSA-N |
| XLogP | 3.73 |
| TPSA | 165.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|