C26H27N2O9P — CID 87063300
(2-methyl-3-nitrophenoxy)-[4-oxo-4-phenylmethoxy-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid (PubChem CID 87063300) has the molecular formula C26H27N2O9P and a molecular weight of 542.48 g/mol. Its IUPAC name is (2-methyl-3-nitrophenoxy)-[4-oxo-4-phenylmethoxy-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid.
| Compound Name | (2-methyl-3-nitrophenoxy)-[4-oxo-4-phenylmethoxy-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid |
|---|---|
| PubChem CID | 87063300 |
| Molecular Formula | C26H27N2O9P |
| Molecular Weight | 542.48 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | (2-methyl-3-nitrophenoxy)-[4-oxo-4-phenylmethoxy-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid |
| SMILES | Cc1c(OP(=O)(O)CCC(NC(=O)OCc2ccccc2)C(=O)OCc2ccccc2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H27N2O9P/c1-19-23(28(31)32)13-8-14-24(19)37-38(33,34)16-15-22(25(29)35-17-20-9-4-2-5-10-20)27-26(30)36-18-21-11-6-3-7-12-21/h2-14,22H,15-18H2,1H3,(H,27,30)(H,33,34) |
| InChIKey | QCEMXLQSWFMNOG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|