C21H23N5O8 — CID 55937927
benzyl N-[(2S)-5-amino-1-[2-[2-(2-nitrophenoxy)acetyl]hydrazinyl]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 55937927) has the molecular formula C21H23N5O8 and a molecular weight of 473.44 g/mol. Its IUPAC name is benzyl N-[(2S)-5-amino-1-[2-[2-(2-nitrophenoxy)acetyl]hydrazinyl]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-5-amino-1-[2-[2-(2-nitrophenoxy)acetyl]hydrazinyl]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 55937927 |
| Molecular Formula | C21H23N5O8 |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | benzyl N-[(2S)-5-amino-1-[2-[2-(2-nitrophenoxy)acetyl]hydrazinyl]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | NC(=O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)NNC(=O)COc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H23N5O8/c22-18(27)11-10-15(23-21(30)34-12-14-6-2-1-3-7-14)20(29)25-24-19(28)13-33-17-9-5-4-8-16(17)26(31)32/h1-9,15H,10-13H2,(H2,22,27)(H,23,30)(H,24,28)(H,25,29)/t15-/m0/s1 |
| InChIKey | SABDQXMRLUYYKY-HNNXBMFYSA-N |
| XLogP | 0.68 |
| TPSA | 191.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|