C24H39NO11P2 — CID 87642146
[2-(diethoxyphosphorylmethyl)-3-ethoxy-2-methyl-3-oxopropyl]-[(3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid (PubChem CID 87642146) has the molecular formula C24H39NO11P2 and a molecular weight of 579.52 g/mol. Its IUPAC name is [2-(diethoxyphosphorylmethyl)-3-ethoxy-2-methyl-3-oxopropyl]-[(3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid.
| Compound Name | [2-(diethoxyphosphorylmethyl)-3-ethoxy-2-methyl-3-oxopropyl]-[(3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid |
|---|---|
| PubChem CID | 87642146 |
| Molecular Formula | C24H39NO11P2 |
| Molecular Weight | 579.52 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | [2-(diethoxyphosphorylmethyl)-3-ethoxy-2-methyl-3-oxopropyl]-[(3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid |
| SMILES | CCOC(=O)C(C)(CP(=O)(O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)OC)CP(=O)(OCC)OCC |
| InChI | InChI=1S/C24H39NO11P2/c1-6-33-22(27)24(4,18-38(31,35-7-2)36-8-3)17-37(29,30)15-14-20(21(26)32-5)25-23(28)34-16-19-12-10-9-11-13-19/h9-13,20H,6-8,14-18H2,1-5H3,(H,25,28)(H,29,30)/t20-,24?/m0/s1 |
| InChIKey | CUOUAMLQTILMGN-QHELBMECSA-N |
| XLogP | 3.95 |
| TPSA | 163.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|