C18H19ClF5NO — CID 171312680
(1R)-1-(3,5-dimethyl-4-phenylmethoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride (PubChem CID 171312680) has the molecular formula C18H19ClF5NO and a molecular weight of 395.80 g/mol. Its IUPAC name is (1R)-1-(3,5-dimethyl-4-phenylmethoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(3,5-dimethyl-4-phenylmethoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171312680 |
| Molecular Formula | C18H19ClF5NO |
| Molecular Weight | 395.80 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (1R)-1-(3,5-dimethyl-4-phenylmethoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride |
| SMILES | Cc1cc([C@@H](N)C(F)(F)C(F)(F)F)cc(C)c1OCc1ccccc1.Cl |
| InChI | InChI=1S/C18H18F5NO.ClH/c1-11-8-14(16(24)17(19,20)18(21,22)23)9-12(2)15(11)25-10-13-6-4-3-5-7-13;/h3-9,16H,10,24H2,1-2H3;1H/t16-;/m1./s1 |
| InChIKey | MZAMJQPVIKPYIZ-PKLMIRHRSA-N |
| XLogP | 5.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.80 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|