C17H22N2O — CID 171214381
(1S)-1-(3,5-dimethyl-4-phenylmethoxyphenyl)ethane-1,2-diamine (PubChem CID 171214381) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is (1S)-1-(3,5-dimethyl-4-phenylmethoxyphenyl)ethane-1,2-diamine.
| Compound Name | (1S)-1-(3,5-dimethyl-4-phenylmethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 171214381 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (1S)-1-(3,5-dimethyl-4-phenylmethoxyphenyl)ethane-1,2-diamine |
| SMILES | Cc1cc([C@H](N)CN)cc(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C17H22N2O/c1-12-8-15(16(19)10-18)9-13(2)17(12)20-11-14-6-4-3-5-7-14/h3-9,16H,10-11,18-19H2,1-2H3/t16-/m1/s1 |
| InChIKey | OXGPMIYQHJDULH-MRXNPFEDSA-N |
| XLogP | 2.84 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |