C18H21NO6S — CID 174560949
(1S)-1-amino-2-methyl-3-oxo-3-[(3-phenylmethoxyphenyl)methoxy]propane-1-sulfonic acid (PubChem CID 174560949) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is (1S)-1-amino-2-methyl-3-oxo-3-[(3-phenylmethoxyphenyl)methoxy]propane-1-sulfonic acid.
| Compound Name | (1S)-1-amino-2-methyl-3-oxo-3-[(3-phenylmethoxyphenyl)methoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 174560949 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | (1S)-1-amino-2-methyl-3-oxo-3-[(3-phenylmethoxyphenyl)methoxy]propane-1-sulfonic acid |
| SMILES | CC(C(=O)OCc1cccc(OCc2ccccc2)c1)[C@@H](N)S(=O)(=O)O |
| InChI | InChI=1S/C18H21NO6S/c1-13(17(19)26(21,22)23)18(20)25-12-15-8-5-9-16(10-15)24-11-14-6-3-2-4-7-14/h2-10,13,17H,11-12,19H2,1H3,(H,21,22,23)/t13?,17-/m0/s1 |
| InChIKey | QEGFQXKSRUVXPG-RUINGEJQSA-N |
| XLogP | 2.12 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|