C31H29NO4 — CID 124746412
benzyl (2R)-2-[(2-phenylacetyl)amino]-3-(3-phenylmethoxyphenyl)propanoate (PubChem CID 124746412) has the molecular formula C31H29NO4 and a molecular weight of 479.58 g/mol. Its IUPAC name is benzyl (2R)-2-[(2-phenylacetyl)amino]-3-(3-phenylmethoxyphenyl)propanoate.
| Compound Name | benzyl (2R)-2-[(2-phenylacetyl)amino]-3-(3-phenylmethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 124746412 |
| Molecular Formula | C31H29NO4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | benzyl (2R)-2-[(2-phenylacetyl)amino]-3-(3-phenylmethoxyphenyl)propanoate |
| SMILES | O=C(Cc1ccccc1)N[C@H](Cc1cccc(OCc2ccccc2)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H29NO4/c33-30(21-24-11-4-1-5-12-24)32-29(31(34)36-23-26-15-8-3-9-16-26)20-27-17-10-18-28(19-27)35-22-25-13-6-2-7-14-25/h1-19,29H,20-23H2,(H,32,33)/t29-/m1/s1 |
| InChIKey | LIFRYIXDZYCNJF-GDLZYMKVSA-N |
| XLogP | 5.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |