C31H27NO5 — CID 21055463
9H-fluoren-9-ylmethyl 2-[(2S)-2-aminopropanoyl]oxy-5-phenylmethoxybenzoate (PubChem CID 21055463) has the molecular formula C31H27NO5 and a molecular weight of 493.56 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 2-[(2S)-2-aminopropanoyl]oxy-5-phenylmethoxybenzoate.
| Compound Name | 9H-fluoren-9-ylmethyl 2-[(2S)-2-aminopropanoyl]oxy-5-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 21055463 |
| Molecular Formula | C31H27NO5 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 2-[(2S)-2-aminopropanoyl]oxy-5-phenylmethoxybenzoate |
| SMILES | C[C@H](N)C(=O)Oc1ccc(OCc2ccccc2)cc1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H27NO5/c1-20(32)30(33)37-29-16-15-22(35-18-21-9-3-2-4-10-21)17-27(29)31(34)36-19-28-25-13-7-5-11-23(25)24-12-6-8-14-26(24)28/h2-17,20,28H,18-19,32H2,1H3/t20-/m0/s1 |
| InChIKey | TUTYRKHUYAEGMP-FQEVSTJZSA-N |
| XLogP | 5.49 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|