About (5-bromonaphthalen-2-yl) (2R)-2-(6-methoxynaphthalen-2-yl)propanoate
(5-bromonaphthalen-2-yl) (2R)-2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 97104193) has the molecular formula C24H19BrO3
and a molecular weight of 435.32 g/mol. Its IUPAC name is (5-bromonaphthalen-2-yl) (2R)-2-(6-methoxynaphthalen-2-yl)propanoate.
Molecular Properties
| Compound Name | (5-bromonaphthalen-2-yl) (2R)-2-(6-methoxynaphthalen-2-yl)propanoate |
| PubChem CID | 97104193 |
| Molecular Formula | C24H19BrO3 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | (5-bromonaphthalen-2-yl) (2R)-2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | COc1ccc2cc([C@@H](C)C(=O)Oc3ccc4c(Br)cccc4c3)ccc2c1 |
| InChI | InChI=1S/C24H19BrO3/c1-15(16-6-7-18-13-20(27-2)9-8-17(18)12-16)24(26)28-21-10-11-22-19(14-21)4-3-5-23(22)25/h3-15H,1-2H3/t15-/m1/s1 |
| InChIKey | IEVYZTREZUZVFL-OAHLLOKOSA-N |
| XLogP | 6.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (5-bromonaphthalen-2-yl) (2R)-2-(6-methoxynaphthalen-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromonaphthalen-2-yl) (2R)-2-(6-methoxynaphthalen-2-yl)propanoate?
The IUPAC name of (5-bromonaphthalen-2-yl) (2R)-2-(6-methoxynaphthalen-2-yl)propanoate (CID 97104193) is (5-bromonaphthalen-2-yl) (2R)-2-(6-methoxynaphthalen-2-yl)propanoate.
What is the SMILES notation for (5-bromonaphthalen-2-yl) (2R)-2-(6-methoxynaphthalen-2-yl)propanoate?
The canonical SMILES for (5-bromonaphthalen-2-yl) (2R)-2-(6-methoxynaphthalen-2-yl)propanoate is COc1ccc2cc([C@@H](C)C(=O)Oc3ccc4c(Br)cccc4c3)ccc2c1.
What is the InChIKey of (5-bromonaphthalen-2-yl) (2R)-2-(6-methoxynaphthalen-2-yl)propanoate?
The InChIKey is IEVYZTREZUZVFL-OAHLLOKOSA-N. The full InChI is InChI=1S/C24H19BrO3/c1-15(16-6-7-18-13-20(27-2)9-8-17(18)12-16)24(26)28-21-10-11-22-19(14-21)4-3-5-23(22)25/h3-15H,1-2H3/t15-/m1/s1.
What are the key properties of (5-bromonaphthalen-2-yl) (2R)-2-(6-methoxynaphthalen-2-yl)propanoate?
(5-bromonaphthalen-2-yl) (2R)-2-(6-methoxynaphthalen-2-yl)propanoate has a molecular weight of 435.32 g/mol, XLogP of 6.47, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromonaphthalen-2-yl) (2R)-2-(6-methoxynaphthalen-2-yl)propanoate is sourced from PubChem (CID 97104193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).