C29H35NO4 — CID 69367890
[3-[2-(dimethylamino)-1-hydroxy-2-methylcyclohexyl]phenyl] 2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 69367890) has the molecular formula C29H35NO4 and a molecular weight of 461.60 g/mol. Its IUPAC name is [3-[2-(dimethylamino)-1-hydroxy-2-methylcyclohexyl]phenyl] 2-(6-methoxynaphthalen-2-yl)propanoate.
| Compound Name | [3-[2-(dimethylamino)-1-hydroxy-2-methylcyclohexyl]phenyl] 2-(6-methoxynaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 69367890 |
| Molecular Formula | C29H35NO4 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | [3-[2-(dimethylamino)-1-hydroxy-2-methylcyclohexyl]phenyl] 2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | COc1ccc2cc(C(C)C(=O)Oc3cccc(C4(O)CCCCC4(C)N(C)C)c3)ccc2c1 |
| InChI | InChI=1S/C29H35NO4/c1-20(21-11-12-23-18-25(33-5)14-13-22(23)17-21)27(31)34-26-10-8-9-24(19-26)29(32)16-7-6-15-28(29,2)30(3)4/h8-14,17-20,32H,6-7,15-16H2,1-5H3 |
| InChIKey | GEURFUMSCYCATK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|