C17H27NO — CID 20571901
2-(3-methoxyphenyl)-N,N,1,2-tetramethylcyclohexan-1-amine (PubChem CID 20571901) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-N,N,1,2-tetramethylcyclohexan-1-amine.
| Compound Name | 2-(3-methoxyphenyl)-N,N,1,2-tetramethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 20571901 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 2-(3-methoxyphenyl)-N,N,1,2-tetramethylcyclohexan-1-amine |
| SMILES | COc1cccc(C2(C)CCCCC2(C)N(C)C)c1 |
| InChI | InChI=1S/C17H27NO/c1-16(14-9-8-10-15(13-14)19-5)11-6-7-12-17(16,2)18(3)4/h8-10,13H,6-7,11-12H2,1-5H3 |
| InChIKey | LQGFESGFXRQMCS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |