C28H26O4 — CID 142024173
2-methyl-6-[[3-[(2-methyl-8H-benzo[7]annulen-7-yl)methoxy]phenoxy]methyl]benzoic acid (PubChem CID 142024173) has the molecular formula C28H26O4 and a molecular weight of 426.51 g/mol. Its IUPAC name is 2-methyl-6-[[3-[(2-methyl-8H-benzo[7]annulen-7-yl)methoxy]phenoxy]methyl]benzoic acid.
| Compound Name | 2-methyl-6-[[3-[(2-methyl-8H-benzo[7]annulen-7-yl)methoxy]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 142024173 |
| Molecular Formula | C28H26O4 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-methyl-6-[[3-[(2-methyl-8H-benzo[7]annulen-7-yl)methoxy]phenoxy]methyl]benzoic acid |
| SMILES | Cc1ccc2c(c1)=CCC(COc1cccc(OCc3cccc(C)c3C(=O)O)c1)=CC=2 |
| InChI | InChI=1S/C28H26O4/c1-19-9-12-22-13-10-21(11-14-23(22)15-19)17-31-25-7-4-8-26(16-25)32-18-24-6-3-5-20(2)27(24)28(29)30/h3-10,12-16H,11,17-18H2,1-2H3,(H,29,30) |
| InChIKey | SEHRDCWNNPGHQH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |