C25H21NO5S — CID 22241421
2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]sulfonylmethyl]benzoic acid (PubChem CID 22241421) has the molecular formula C25H21NO5S and a molecular weight of 447.51 g/mol. Its IUPAC name is 2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]sulfonylmethyl]benzoic acid.
| Compound Name | 2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]sulfonylmethyl]benzoic acid |
|---|---|
| PubChem CID | 22241421 |
| Molecular Formula | C25H21NO5S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]sulfonylmethyl]benzoic acid |
| SMILES | Cc1cccc(CS(=O)(=O)c2cccc(OCc3ccc4ccccc4n3)c2)c1C(=O)O |
| InChI | InChI=1S/C25H21NO5S/c1-17-6-4-8-19(24(17)25(27)28)16-32(29,30)22-10-5-9-21(14-22)31-15-20-13-12-18-7-2-3-11-23(18)26-20/h2-14H,15-16H2,1H3,(H,27,28) |
| InChIKey | HZXKDTRSSUYMCV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |