C45H48N2O8 — CID 157213046
methyl 2-methyl-6-[3-(quinolin-2-ylmethoxy)propoxymethyl]benzoate;2-methyl-6-[3-(quinolin-2-ylmethoxy)propoxymethyl]benzoic acid (PubChem CID 157213046) has the molecular formula C45H48N2O8 and a molecular weight of 744.89 g/mol. Its IUPAC name is methyl 2-methyl-6-[3-(quinolin-2-ylmethoxy)propoxymethyl]benzoate;2-methyl-6-[3-(quinolin-2-ylmethoxy)propoxymethyl]benzoic acid.
| Compound Name | methyl 2-methyl-6-[3-(quinolin-2-ylmethoxy)propoxymethyl]benzoate;2-methyl-6-[3-(quinolin-2-ylmethoxy)propoxymethyl]benzoic acid |
|---|---|
| PubChem CID | 157213046 |
| Molecular Formula | C45H48N2O8 |
| Molecular Weight | 744.89 g/mol |
| Exact Mass | 744.34 |
| IUPAC Name | methyl 2-methyl-6-[3-(quinolin-2-ylmethoxy)propoxymethyl]benzoate;2-methyl-6-[3-(quinolin-2-ylmethoxy)propoxymethyl]benzoic acid |
| SMILES | COC(=O)c1c(C)cccc1COCCCOCc1ccc2ccccc2n1.Cc1cccc(COCCCOCc2ccc3ccccc3n2)c1C(=O)O |
| InChI | InChI=1S/C23H25NO4.C22H23NO4/c1-17-7-5-9-19(22(17)23(25)26-2)15-27-13-6-14-28-16-20-12-11-18-8-3-4-10-21(18)24-20;1-16-6-4-8-18(21(16)22(24)25)14-26-12-5-13-27-15-19-11-10-17-7-2-3-9-20(17)23-19/h3-5,7-12H,6,13-16H2,1-2H3;2-4,6-11H,5,12-15H2,1H3,(H,24,25) |
| InChIKey | ASCJQKPDJYRIFE-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.89 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|