C46H43IN2O6 — CID 68617677
4-(iodomethyl)-2-(4-methylphenyl)-5-phenyl-1,3-oxazole;2-methyl-6-[3-[[2-(4-methylphenyl)-5-phenyl-1,3-oxazol-4-yl]methoxy]propoxymethyl]benzoic acid (PubChem CID 68617677) has the molecular formula C46H43IN2O6 and a molecular weight of 846.76 g/mol. Its IUPAC name is 4-(iodomethyl)-2-(4-methylphenyl)-5-phenyl-1,3-oxazole;2-methyl-6-[3-[[2-(4-methylphenyl)-5-phenyl-1,3-oxazol-4-yl]methoxy]propoxymethyl]benzoic acid.
| Compound Name | 4-(iodomethyl)-2-(4-methylphenyl)-5-phenyl-1,3-oxazole;2-methyl-6-[3-[[2-(4-methylphenyl)-5-phenyl-1,3-oxazol-4-yl]methoxy]propoxymethyl]benzoic acid |
|---|---|
| PubChem CID | 68617677 |
| Molecular Formula | C46H43IN2O6 |
| Molecular Weight | 846.76 g/mol |
| Exact Mass | 846.22 |
| IUPAC Name | 4-(iodomethyl)-2-(4-methylphenyl)-5-phenyl-1,3-oxazole;2-methyl-6-[3-[[2-(4-methylphenyl)-5-phenyl-1,3-oxazol-4-yl]methoxy]propoxymethyl]benzoic acid |
| SMILES | Cc1ccc(-c2nc(CI)c(-c3ccccc3)o2)cc1.Cc1ccc(-c2nc(COCCCOCc3cccc(C)c3C(=O)O)c(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C29H29NO5.C17H14INO/c1-20-12-14-23(15-13-20)28-30-25(27(35-28)22-9-4-3-5-10-22)19-34-17-7-16-33-18-24-11-6-8-21(2)26(24)29(31)32;1-12-7-9-14(10-8-12)17-19-15(11-18)16(20-17)13-5-3-2-4-6-13/h3-6,8-15H,7,16-19H2,1-2H3,(H,31,32);2-10H,11H2,1H3 |
| InChIKey | DPXFPPAZPLXDCE-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.76 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|