C26H28F3NO5 — CID 11990407
2-methyl-6-[3-[[5-propan-2-yl-2-[3-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]propoxymethyl]benzoic acid (PubChem CID 11990407) has the molecular formula C26H28F3NO5 and a molecular weight of 491.51 g/mol. Its IUPAC name is 2-methyl-6-[3-[[5-propan-2-yl-2-[3-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]propoxymethyl]benzoic acid.
| Compound Name | 2-methyl-6-[3-[[5-propan-2-yl-2-[3-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]propoxymethyl]benzoic acid |
|---|---|
| PubChem CID | 11990407 |
| Molecular Formula | C26H28F3NO5 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 2-methyl-6-[3-[[5-propan-2-yl-2-[3-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]propoxymethyl]benzoic acid |
| SMILES | Cc1cccc(COCCCOCc2nc(-c3cccc(C(F)(F)F)c3)oc2C(C)C)c1C(=O)O |
| InChI | InChI=1S/C26H28F3NO5/c1-16(2)23-21(30-24(35-23)18-8-5-10-20(13-18)26(27,28)29)15-34-12-6-11-33-14-19-9-4-7-17(3)22(19)25(31)32/h4-5,7-10,13,16H,6,11-12,14-15H2,1-3H3,(H,31,32) |
| InChIKey | UWHTWXJZEIBDIC-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|