C26H31NO4 — CID 10112932
6-[(2,5-diphenyl-1,3-oxazol-4-yl)methoxy]hexyl butanoate (PubChem CID 10112932) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is 6-[(2,5-diphenyl-1,3-oxazol-4-yl)methoxy]hexyl butanoate.
| Compound Name | 6-[(2,5-diphenyl-1,3-oxazol-4-yl)methoxy]hexyl butanoate |
|---|---|
| PubChem CID | 10112932 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 6-[(2,5-diphenyl-1,3-oxazol-4-yl)methoxy]hexyl butanoate |
| SMILES | CCCC(=O)OCCCCCCOCc1nc(-c2ccccc2)oc1-c1ccccc1 |
| InChI | InChI=1S/C26H31NO4/c1-2-13-24(28)30-19-12-4-3-11-18-29-20-23-25(21-14-7-5-8-15-21)31-26(27-23)22-16-9-6-10-17-22/h5-10,14-17H,2-4,11-13,18-20H2,1H3 |
| InChIKey | PBYKURUFTCMTJT-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|