C25H29N3O4 — CID 30593411
4-hexoxy-N'-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetyl]benzohydrazide (PubChem CID 30593411) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is 4-hexoxy-N'-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetyl]benzohydrazide.
| Compound Name | 4-hexoxy-N'-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 30593411 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 4-hexoxy-N'-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetyl]benzohydrazide |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=O)Cc2nc(-c3ccccc3)oc2C)cc1 |
| InChI | InChI=1S/C25H29N3O4/c1-3-4-5-9-16-31-21-14-12-19(13-15-21)24(30)28-27-23(29)17-22-18(2)32-25(26-22)20-10-7-6-8-11-20/h6-8,10-15H,3-5,9,16-17H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | FITPBDZCJFTBKM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|