C15H18N2O3S — CID 2053876
pentyl 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate (PubChem CID 2053876) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is pentyl 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate.
| Compound Name | pentyl 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 2053876 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | pentyl 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate |
| SMILES | CCCCCOC(=O)CSc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C15H18N2O3S/c1-2-3-7-10-19-13(18)11-21-15-17-16-14(20-15)12-8-5-4-6-9-12/h4-6,8-9H,2-3,7,10-11H2,1H3 |
| InChIKey | SSTKLUSXIBXKIH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|