C36H27O9P — CID 139895708
[3,5-dibenzoyloxy-4-(2,6-dimethoxybenzoyl)phosphanylphenyl] benzoate (PubChem CID 139895708) has the molecular formula C36H27O9P and a molecular weight of 634.58 g/mol. Its IUPAC name is [3,5-dibenzoyloxy-4-(2,6-dimethoxybenzoyl)phosphanylphenyl] benzoate.
| Compound Name | [3,5-dibenzoyloxy-4-(2,6-dimethoxybenzoyl)phosphanylphenyl] benzoate |
|---|---|
| PubChem CID | 139895708 |
| Molecular Formula | C36H27O9P |
| Molecular Weight | 634.58 g/mol |
| Exact Mass | 634.14 |
| IUPAC Name | [3,5-dibenzoyloxy-4-(2,6-dimethoxybenzoyl)phosphanylphenyl] benzoate |
| SMILES | COc1cccc(OC)c1C(=O)Pc1c(OC(=O)c2ccccc2)cc(OC(=O)c2ccccc2)cc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H27O9P/c1-41-27-19-12-20-28(42-2)31(27)36(40)46-32-29(44-34(38)24-15-8-4-9-16-24)21-26(43-33(37)23-13-6-3-7-14-23)22-30(32)45-35(39)25-17-10-5-11-18-25/h3-22,46H,1-2H3 |
| InChIKey | VHPYGLWNVOKEAY-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.58 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|