C15H22LiO3P — CID 174440508
lithium;cyclopentylphosphanyl-(2,6-dimethoxy-4-methylphenyl)methanone;hydride (PubChem CID 174440508) has the molecular formula C15H22LiO3P and a molecular weight of 288.25 g/mol. Its IUPAC name is lithium;cyclopentylphosphanyl-(2,6-dimethoxy-4-methylphenyl)methanone;hydride.
| Compound Name | lithium;cyclopentylphosphanyl-(2,6-dimethoxy-4-methylphenyl)methanone;hydride |
|---|---|
| PubChem CID | 174440508 |
| Molecular Formula | C15H22LiO3P |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | lithium;cyclopentylphosphanyl-(2,6-dimethoxy-4-methylphenyl)methanone;hydride |
| SMILES | COc1cc(C)cc(OC)c1C(=O)PC1CCCC1.[H-].[Li+] |
| InChI | InChI=1S/C15H21O3P.Li.H/c1-10-8-12(17-2)14(13(9-10)18-3)15(16)19-11-6-4-5-7-11;;/h8-9,11,19H,4-7H2,1-3H3;;/q;+1;-1 |
| InChIKey | ROVQWXBAZOQOIZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|