C15H22LiOP — CID 174463897
lithium;cyclopentylphosphanyl-(2,3,6-trimethylphenyl)methanone;hydride (PubChem CID 174463897) has the molecular formula C15H22LiOP and a molecular weight of 256.25 g/mol. Its IUPAC name is lithium;cyclopentylphosphanyl-(2,3,6-trimethylphenyl)methanone;hydride.
| Compound Name | lithium;cyclopentylphosphanyl-(2,3,6-trimethylphenyl)methanone;hydride |
|---|---|
| PubChem CID | 174463897 |
| Molecular Formula | C15H22LiOP |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | lithium;cyclopentylphosphanyl-(2,3,6-trimethylphenyl)methanone;hydride |
| SMILES | Cc1ccc(C)c(C(=O)PC2CCCC2)c1C.[H-].[Li+] |
| InChI | InChI=1S/C15H21OP.Li.H/c1-10-8-9-11(2)14(12(10)3)15(16)17-13-6-4-5-7-13;;/h8-9,13,17H,4-7H2,1-3H3;;/q;+1;-1 |
| InChIKey | FLVBUGSQCKTEEQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|