C19H21LiOP — CID 159103638
CID 159103638 (PubChem CID 159103638) has the molecular formula C19H21LiOP and a molecular weight of 303.29 g/mol.
| Compound Name | CID 159103638 |
|---|---|
| PubChem CID | 159103638 |
| Molecular Formula | C19H21LiOP |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | — |
| SMILES | Cc1cccc(-c2ccccc2)c1C(=O)PC1CCCC1.[Li] |
| InChI | InChI=1S/C19H21OP.Li/c1-14-8-7-13-17(15-9-3-2-4-10-15)18(14)19(20)21-16-11-5-6-12-16;/h2-4,7-10,13,16,21H,5-6,11-12H2,1H3; |
| InChIKey | KDPIHQQOELDXIS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|